C14H18F6N2O2 — CID 135259065
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,4-bis(trifluoromethyl)aniline (PubChem CID 135259065) has the molecular formula C14H18F6N2O2 and a molecular weight of 360.30 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,4-bis(trifluoromethyl)aniline.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,4-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 135259065 |
| Molecular Formula | C14H18F6N2O2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,4-bis(trifluoromethyl)aniline |
| SMILES | NCCOCCOCCNc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F6N2O2/c15-13(16,17)10-1-2-12(11(9-10)14(18,19)20)22-4-6-24-8-7-23-5-3-21/h1-2,9,22H,3-8,21H2 |
| InChIKey | UUYOAUMHBWXTRF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|