C13H14BrClFNO3 — CID 164842730
tert-butyl N-[4-(2-bromoacetyl)-2-chloro-3-fluorophenyl]carbamate (PubChem CID 164842730) has the molecular formula C13H14BrClFNO3 and a molecular weight of 366.61 g/mol. Its IUPAC name is tert-butyl N-[4-(2-bromoacetyl)-2-chloro-3-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-bromoacetyl)-2-chloro-3-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 164842730 |
| Molecular Formula | C13H14BrClFNO3 |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | tert-butyl N-[4-(2-bromoacetyl)-2-chloro-3-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)CBr)c(F)c1Cl |
| InChI | InChI=1S/C13H14BrClFNO3/c1-13(2,3)20-12(19)17-8-5-4-7(9(18)6-14)11(16)10(8)15/h4-5H,6H2,1-3H3,(H,17,19) |
| InChIKey | IVCIXBODJNEBLL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|