C14H15BrF3NO4 — CID 164842628
tert-butyl N-[4-(2-bromoacetyl)-2-(trifluoromethoxy)phenyl]carbamate (PubChem CID 164842628) has the molecular formula C14H15BrF3NO4 and a molecular weight of 398.18 g/mol. Its IUPAC name is tert-butyl N-[4-(2-bromoacetyl)-2-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-bromoacetyl)-2-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 164842628 |
| Molecular Formula | C14H15BrF3NO4 |
| Molecular Weight | 398.18 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | tert-butyl N-[4-(2-bromoacetyl)-2-(trifluoromethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)CBr)cc1OC(F)(F)F |
| InChI | InChI=1S/C14H15BrF3NO4/c1-13(2,3)23-12(21)19-9-5-4-8(10(20)7-15)6-11(9)22-14(16,17)18/h4-6H,7H2,1-3H3,(H,19,21) |
| InChIKey | BNNKTDDAFMHNMK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.18 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|