C16H23ClN2O3 — CID 166067735
tert-butyl N-[2-[2-chloro-4-(1-ethoxyethenyl)-3-pyridinyl]ethyl]carbamate (PubChem CID 166067735) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is tert-butyl N-[2-[2-chloro-4-(1-ethoxyethenyl)-3-pyridinyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-chloro-4-(1-ethoxyethenyl)-3-pyridinyl]ethyl]carbamate |
|---|---|
| PubChem CID | 166067735 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | tert-butyl N-[2-[2-chloro-4-(1-ethoxyethenyl)-3-pyridinyl]ethyl]carbamate |
| SMILES | C=C(OCC)c1ccnc(Cl)c1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23ClN2O3/c1-6-21-11(2)12-7-9-18-14(17)13(12)8-10-19-15(20)22-16(3,4)5/h7,9H,2,6,8,10H2,1,3-5H3,(H,19,20) |
| InChIKey | IDAGBIGCFLIFSI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|