C12H15Cl2NO2 — CID 117236568
tert-butyl N-[4-chloro-2-(chloromethyl)phenyl]carbamate (PubChem CID 117236568) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-2-(chloromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-chloro-2-(chloromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 117236568 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | tert-butyl N-[4-chloro-2-(chloromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)cc1CCl |
| InChI | InChI=1S/C12H15Cl2NO2/c1-12(2,3)17-11(16)15-10-5-4-9(14)6-8(10)7-13/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | AHBGDKCYIVRRJE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|