C11H16ClN2O2+ — CID 144745130
[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]azanium (PubChem CID 144745130) has the molecular formula C11H16ClN2O2+ and a molecular weight of 243.71 g/mol. Its IUPAC name is [5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]azanium.
| Compound Name | [5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]azanium |
|---|---|
| PubChem CID | 144745130 |
| Molecular Formula | C11H16ClN2O2+ |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | [5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]azanium |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)cc1[NH3+] |
| InChI | InChI=1S/C11H15ClN2O2/c1-11(2,3)16-10(15)14-9-5-4-7(12)6-8(9)13/h4-6H,13H2,1-3H3,(H,14,15)/p+1 |
| InChIKey | RAAXZOKVGWKKCP-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |