C20H22ClNO2 — CID 23074928
tert-butyl N-[4-[1-(4-chlorophenyl)ethenyl]-2-methylphenyl]carbamate (PubChem CID 23074928) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(4-chlorophenyl)ethenyl]-2-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(4-chlorophenyl)ethenyl]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 23074928 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | tert-butyl N-[4-[1-(4-chlorophenyl)ethenyl]-2-methylphenyl]carbamate |
| SMILES | C=C(c1ccc(Cl)cc1)c1ccc(NC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C20H22ClNO2/c1-13-12-16(14(2)15-6-9-17(21)10-7-15)8-11-18(13)22-19(23)24-20(3,4)5/h6-12H,2H2,1,3-5H3,(H,22,23) |
| InChIKey | GTXBWECXVXIUAB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |