C13H19ClN2O3S — CID 66256512
N-(2-chloro-6-methyl-4-sulfamoylphenyl)-2,2-dimethylbutanamide (PubChem CID 66256512) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is N-(2-chloro-6-methyl-4-sulfamoylphenyl)-2,2-dimethylbutanamide.
| Compound Name | N-(2-chloro-6-methyl-4-sulfamoylphenyl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 66256512 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(2-chloro-6-methyl-4-sulfamoylphenyl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1c(C)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O3S/c1-5-13(3,4)12(17)16-11-8(2)6-9(7-10(11)14)20(15,18)19/h6-7H,5H2,1-4H3,(H,16,17)(H2,15,18,19) |
| InChIKey | DLTRASSRRWKBCM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |