C12H15ClN2O3S — CID 66255370
N-(2-chloro-6-methyl-4-sulfamoylphenyl)cyclobutanecarboxamide (PubChem CID 66255370) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is N-(2-chloro-6-methyl-4-sulfamoylphenyl)cyclobutanecarboxamide.
| Compound Name | N-(2-chloro-6-methyl-4-sulfamoylphenyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 66255370 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-(2-chloro-6-methyl-4-sulfamoylphenyl)cyclobutanecarboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(Cl)c1NC(=O)C1CCC1 |
| InChI | InChI=1S/C12H15ClN2O3S/c1-7-5-9(19(14,17)18)6-10(13)11(7)15-12(16)8-3-2-4-8/h5-6,8H,2-4H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | HOUFFVSKWYTHMH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |