C14H17Cl2NO3S — CID 107180023
3-chloro-5-methyl-4-[(2-methylcyclopentanecarbonyl)amino]benzenesulfonyl chloride (PubChem CID 107180023) has the molecular formula C14H17Cl2NO3S and a molecular weight of 350.27 g/mol. Its IUPAC name is 3-chloro-5-methyl-4-[(2-methylcyclopentanecarbonyl)amino]benzenesulfonyl chloride.
| Compound Name | 3-chloro-5-methyl-4-[(2-methylcyclopentanecarbonyl)amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 107180023 |
| Molecular Formula | C14H17Cl2NO3S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 3-chloro-5-methyl-4-[(2-methylcyclopentanecarbonyl)amino]benzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)cc(Cl)c1NC(=O)C1CCCC1C |
| InChI | InChI=1S/C14H17Cl2NO3S/c1-8-4-3-5-11(8)14(18)17-13-9(2)6-10(7-12(13)15)21(16,19)20/h6-8,11H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | TYWYTSBBXISAQN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |