C13H10Cl2N2O3S — CID 66262671
3-chloro-5-methyl-4-(pyridine-4-carbonylamino)benzenesulfonyl chloride (PubChem CID 66262671) has the molecular formula C13H10Cl2N2O3S and a molecular weight of 345.21 g/mol. Its IUPAC name is 3-chloro-5-methyl-4-(pyridine-4-carbonylamino)benzenesulfonyl chloride.
| Compound Name | 3-chloro-5-methyl-4-(pyridine-4-carbonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 66262671 |
| Molecular Formula | C13H10Cl2N2O3S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 3-chloro-5-methyl-4-(pyridine-4-carbonylamino)benzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)cc(Cl)c1NC(=O)c1ccncc1 |
| InChI | InChI=1S/C13H10Cl2N2O3S/c1-8-6-10(21(15,19)20)7-11(14)12(8)17-13(18)9-2-4-16-5-3-9/h2-7H,1H3,(H,17,18) |
| InChIKey | NZXHTJYPZJTZFM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |