C13H12ClN3O3S — CID 66254800
N-(2-chloro-6-methyl-4-sulfamoylphenyl)pyridine-2-carboxamide (PubChem CID 66254800) has the molecular formula C13H12ClN3O3S and a molecular weight of 325.78 g/mol. Its IUPAC name is N-(2-chloro-6-methyl-4-sulfamoylphenyl)pyridine-2-carboxamide.
| Compound Name | N-(2-chloro-6-methyl-4-sulfamoylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66254800 |
| Molecular Formula | C13H12ClN3O3S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(2-chloro-6-methyl-4-sulfamoylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(Cl)c1NC(=O)c1ccccn1 |
| InChI | InChI=1S/C13H12ClN3O3S/c1-8-6-9(21(15,19)20)7-10(14)12(8)17-13(18)11-4-2-3-5-16-11/h2-7H,1H3,(H,17,18)(H2,15,19,20) |
| InChIKey | VBLKFNQZAILFOC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |