C15H22N2O3S — CID 43134132
N-(2,6-diethyl-4-sulfamoylphenyl)cyclobutanecarboxamide (PubChem CID 43134132) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is N-(2,6-diethyl-4-sulfamoylphenyl)cyclobutanecarboxamide.
| Compound Name | N-(2,6-diethyl-4-sulfamoylphenyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 43134132 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(2,6-diethyl-4-sulfamoylphenyl)cyclobutanecarboxamide |
| SMILES | CCc1cc(S(N)(=O)=O)cc(CC)c1NC(=O)C1CCC1 |
| InChI | InChI=1S/C15H22N2O3S/c1-3-10-8-13(21(16,19)20)9-11(4-2)14(10)17-15(18)12-6-5-7-12/h8-9,12H,3-7H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | AWCSKGPLYNZREQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |