C14H22N2O3S — CID 43246820
N-(2,6-dimethyl-4-sulfamoylphenyl)-2-ethylbutanamide (PubChem CID 43246820) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-sulfamoylphenyl)-2-ethylbutanamide.
| Compound Name | N-(2,6-dimethyl-4-sulfamoylphenyl)-2-ethylbutanamide |
|---|---|
| PubChem CID | 43246820 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(2,6-dimethyl-4-sulfamoylphenyl)-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1c(C)cc(S(N)(=O)=O)cc1C |
| InChI | InChI=1S/C14H22N2O3S/c1-5-11(6-2)14(17)16-13-9(3)7-12(8-10(13)4)20(15,18)19/h7-8,11H,5-6H2,1-4H3,(H,16,17)(H2,15,18,19) |
| InChIKey | SQRJCROXDUYKII-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |