C7H8Cl2N2O4S2 — CID 43134231
3,5-dichloro-4-(methanesulfonamido)benzenesulfonamide (PubChem CID 43134231) has the molecular formula C7H8Cl2N2O4S2 and a molecular weight of 319.19 g/mol. Its IUPAC name is 3,5-dichloro-4-(methanesulfonamido)benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(methanesulfonamido)benzenesulfonamide |
|---|---|
| PubChem CID | 43134231 |
| Molecular Formula | C7H8Cl2N2O4S2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 3,5-dichloro-4-(methanesulfonamido)benzenesulfonamide |
| SMILES | CS(=O)(=O)Nc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C7H8Cl2N2O4S2/c1-16(12,13)11-7-5(8)2-4(3-6(7)9)17(10,14)15/h2-3,11H,1H3,(H2,10,14,15) |
| InChIKey | RTARNZVEGLWJKL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |