C7H8Cl2N2O2S — CID 16774025
N-(2-amino-4,6-dichlorophenyl)methanesulfonamide (PubChem CID 16774025) has the molecular formula C7H8Cl2N2O2S and a molecular weight of 255.13 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)methanesulfonamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 16774025 |
| Molecular Formula | C7H8Cl2N2O2S |
| Molecular Weight | 255.13 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H8Cl2N2O2S/c1-14(12,13)11-7-5(9)2-4(8)3-6(7)10/h2-3,11H,10H2,1H3 |
| InChIKey | PLNQYAMKVLQBQX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.13 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|