C7H8Br2N2O2S — CID 43550705
N-(2-amino-4,6-dibromophenyl)methanesulfonamide (PubChem CID 43550705) has the molecular formula C7H8Br2N2O2S and a molecular weight of 344.03 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)methanesulfonamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 43550705 |
| Molecular Formula | C7H8Br2N2O2S |
| Molecular Weight | 344.03 g/mol |
| Exact Mass | 341.87 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C7H8Br2N2O2S/c1-14(12,13)11-7-5(9)2-4(8)3-6(7)10/h2-3,11H,10H2,1H3 |
| InChIKey | MEHRSTBKYVYWKI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.03 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|