C11H14Br2N2O3S — CID 62047703
N-(2-amino-4,6-dibromophenyl)oxane-4-sulfonamide (PubChem CID 62047703) has the molecular formula C11H14Br2N2O3S and a molecular weight of 414.12 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)oxane-4-sulfonamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)oxane-4-sulfonamide |
|---|---|
| PubChem CID | 62047703 |
| Molecular Formula | C11H14Br2N2O3S |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)oxane-4-sulfonamide |
| SMILES | Nc1cc(Br)cc(Br)c1NS(=O)(=O)C1CCOCC1 |
| InChI | InChI=1S/C11H14Br2N2O3S/c12-7-5-9(13)11(10(14)6-7)15-19(16,17)8-1-3-18-4-2-8/h5-6,8,15H,1-4,14H2 |
| InChIKey | BMNTWEDXVQFFSF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|