C10H12Cl3NO2S — CID 63190712
2,4,6-trichloro-N-(3-methylsulfonylpropyl)aniline (PubChem CID 63190712) has the molecular formula C10H12Cl3NO2S and a molecular weight of 316.64 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(3-methylsulfonylpropyl)aniline.
| Compound Name | 2,4,6-trichloro-N-(3-methylsulfonylpropyl)aniline |
|---|---|
| PubChem CID | 63190712 |
| Molecular Formula | C10H12Cl3NO2S |
| Molecular Weight | 316.64 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 2,4,6-trichloro-N-(3-methylsulfonylpropyl)aniline |
| SMILES | CS(=O)(=O)CCCNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl3NO2S/c1-17(15,16)4-2-3-14-10-8(12)5-7(11)6-9(10)13/h5-6,14H,2-4H2,1H3 |
| InChIKey | BWFMGVWPHJSDCC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|