C6H4Br2ClNO2S — CID 171008956
3,4-dibromo-5-chlorobenzenesulfonamide (PubChem CID 171008956) has the molecular formula C6H4Br2ClNO2S and a molecular weight of 349.43 g/mol. Its IUPAC name is 3,4-dibromo-5-chlorobenzenesulfonamide.
| Compound Name | 3,4-dibromo-5-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 171008956 |
| Molecular Formula | C6H4Br2ClNO2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 346.80 |
| IUPAC Name | 3,4-dibromo-5-chlorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(Br)c(Br)c1 |
| InChI | InChI=1S/C6H4Br2ClNO2S/c7-4-1-3(13(10,11)12)2-5(9)6(4)8/h1-2H,(H2,10,11,12) |
| InChIKey | YEQLGRWINJATNK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|