C6H8BrN3O4S2 — CID 22323981
4-amino-5-bromobenzene-1,3-disulfonamide (PubChem CID 22323981) has the molecular formula C6H8BrN3O4S2 and a molecular weight of 330.19 g/mol. Its IUPAC name is 4-amino-5-bromobenzene-1,3-disulfonamide.
| Compound Name | 4-amino-5-bromobenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 22323981 |
| Molecular Formula | C6H8BrN3O4S2 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 328.91 |
| IUPAC Name | 4-amino-5-bromobenzene-1,3-disulfonamide |
| SMILES | Nc1c(Br)cc(S(N)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C6H8BrN3O4S2/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14/h1-2H,8H2,(H2,9,11,12)(H2,10,13,14) |
| InChIKey | OPKQRYBDJWZCFW-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|