C8H7Br2NO2S — CID 70537279
2,6-dibromo-4-ethenylsulfonylaniline (PubChem CID 70537279) has the molecular formula C8H7Br2NO2S and a molecular weight of 341.02 g/mol. Its IUPAC name is 2,6-dibromo-4-ethenylsulfonylaniline.
| Compound Name | 2,6-dibromo-4-ethenylsulfonylaniline |
|---|---|
| PubChem CID | 70537279 |
| Molecular Formula | C8H7Br2NO2S |
| Molecular Weight | 341.02 g/mol |
| Exact Mass | 338.86 |
| IUPAC Name | 2,6-dibromo-4-ethenylsulfonylaniline |
| SMILES | C=CS(=O)(=O)c1cc(Br)c(N)c(Br)c1 |
| InChI | InChI=1S/C8H7Br2NO2S/c1-2-14(12,13)5-3-6(9)8(11)7(10)4-5/h2-4H,1,11H2 |
| InChIKey | RZRHHXXGGIQKMI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.02 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|