C10H4Br2F9NO2S — CID 23123884
2,6-dibromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)aniline (PubChem CID 23123884) has the molecular formula C10H4Br2F9NO2S and a molecular weight of 533.00 g/mol. Its IUPAC name is 2,6-dibromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)aniline.
| Compound Name | 2,6-dibromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)aniline |
|---|---|
| PubChem CID | 23123884 |
| Molecular Formula | C10H4Br2F9NO2S |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 530.82 |
| IUPAC Name | 2,6-dibromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)aniline |
| SMILES | Nc1c(Br)cc(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C10H4Br2F9NO2S/c11-4-1-3(2-5(12)6(4)22)25(23,24)10(20,21)8(15,16)7(13,14)9(17,18)19/h1-2H,22H2 |
| InChIKey | SODCKWVTISXYRR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|