C13H13BrN2O4S2 — CID 70565930
3-(4-amino-3-bromophenyl)sulfonyl-4-methylbenzenesulfonamide (PubChem CID 70565930) has the molecular formula C13H13BrN2O4S2 and a molecular weight of 405.30 g/mol. Its IUPAC name is 3-(4-amino-3-bromophenyl)sulfonyl-4-methylbenzenesulfonamide.
| Compound Name | 3-(4-amino-3-bromophenyl)sulfonyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 70565930 |
| Molecular Formula | C13H13BrN2O4S2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 3-(4-amino-3-bromophenyl)sulfonyl-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1S(=O)(=O)c1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C13H13BrN2O4S2/c1-8-2-3-10(22(16,19)20)7-13(8)21(17,18)9-4-5-12(15)11(14)6-9/h2-7H,15H2,1H3,(H2,16,19,20) |
| InChIKey | ARQCLYKJODPNCS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|