C13H12Br2N2O4S2 — CID 70563449
3-(4-amino-2,5-dibromophenyl)sulfonyl-4-methylbenzenesulfonamide (PubChem CID 70563449) has the molecular formula C13H12Br2N2O4S2 and a molecular weight of 484.19 g/mol. Its IUPAC name is 3-(4-amino-2,5-dibromophenyl)sulfonyl-4-methylbenzenesulfonamide.
| Compound Name | 3-(4-amino-2,5-dibromophenyl)sulfonyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 70563449 |
| Molecular Formula | C13H12Br2N2O4S2 |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.86 |
| IUPAC Name | 3-(4-amino-2,5-dibromophenyl)sulfonyl-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1S(=O)(=O)c1cc(Br)c(N)cc1Br |
| InChI | InChI=1S/C13H12Br2N2O4S2/c1-7-2-3-8(23(17,20)21)4-12(7)22(18,19)13-6-9(14)11(16)5-10(13)15/h2-6H,16H2,1H3,(H2,17,20,21) |
| InChIKey | XPGBRESVYIINBN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|