C8H11NO4S2 — CID 597880
2-methyl-5-methylsulfonylbenzenesulfonamide (PubChem CID 597880) has the molecular formula C8H11NO4S2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-methyl-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-methyl-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 597880 |
| Molecular Formula | C8H11NO4S2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2-methyl-5-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H11NO4S2/c1-6-3-4-7(14(2,10)11)5-8(6)15(9,12)13/h3-5H,1-2H3,(H2,9,12,13) |
| InChIKey | HOKCNQPJWCGBPW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |