C16H20N2O6S3 — CID 55904615
2-methyl-5-methylsulfonyl-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 55904615) has the molecular formula C16H20N2O6S3 and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-methyl-5-methylsulfonyl-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2-methyl-5-methylsulfonyl-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55904615 |
| Molecular Formula | C16H20N2O6S3 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-methyl-5-methylsulfonyl-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1S(=O)(=O)NC(C)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H20N2O6S3/c1-11-7-8-14(25(3,19)20)10-16(11)27(23,24)18-12(2)13-5-4-6-15(9-13)26(17,21)22/h4-10,12,18H,1-3H3,(H2,17,21,22) |
| InChIKey | QPCCCXPCQFWQDC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |