C14H14F2N2O4S2 — CID 51278324
3,5-difluoro-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 51278324) has the molecular formula C14H14F2N2O4S2 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3,5-difluoro-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51278324 |
| Molecular Formula | C14H14F2N2O4S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 3,5-difluoro-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(F)cc(F)c1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H14F2N2O4S2/c1-9(10-3-2-4-13(5-10)23(17,19)20)18-24(21,22)14-7-11(15)6-12(16)8-14/h2-9,18H,1H3,(H2,17,19,20) |
| InChIKey | JZSXQMLHWQFIPE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |