C14H15FN2O2S — CID 43762132
3-[1-(3-fluoroanilino)ethyl]benzenesulfonamide (PubChem CID 43762132) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-[1-(3-fluoroanilino)ethyl]benzenesulfonamide.
| Compound Name | 3-[1-(3-fluoroanilino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43762132 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-[1-(3-fluoroanilino)ethyl]benzenesulfonamide |
| SMILES | CC(Nc1cccc(F)c1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H15FN2O2S/c1-10(17-13-6-3-5-12(15)9-13)11-4-2-7-14(8-11)20(16,18)19/h2-10,17H,1H3,(H2,16,18,19) |
| InChIKey | PMWVGURLIFUSRC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |