C16H18N2O6S3 — CID 55895275
1-(2-methyl-5-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 55895275) has the molecular formula C16H18N2O6S3 and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-(2-methyl-5-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(2-methyl-5-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 55895275 |
| Molecular Formula | C16H18N2O6S3 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 1-(2-methyl-5-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1S(=O)(=O)N1CCc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C16H18N2O6S3/c1-11-3-4-13(25(2,19)20)10-16(11)27(23,24)18-8-7-12-9-14(26(17,21)22)5-6-15(12)18/h3-6,9-10H,7-8H2,1-2H3,(H2,17,21,22) |
| InChIKey | XTTXRWYVFDXFJX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |