C16H14N4O6S2 — CID 24622202
1-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 24622202) has the molecular formula C16H14N4O6S2 and a molecular weight of 422.44 g/mol. Its IUPAC name is 1-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 24622202 |
| Molecular Formula | C16H14N4O6S2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 1-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H14N4O6S2/c17-27(23,24)10-2-4-14-9(7-10)5-6-20(14)28(25,26)11-1-3-12-13(8-11)19-16(22)15(21)18-12/h1-4,7-8H,5-6H2,(H,18,21)(H,19,22)(H2,17,23,24) |
| InChIKey | SZUIKVSCKUJSRK-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 163.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|