C17H18N2O6S2 — CID 24563287
3-[4-[(5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]phenyl]propanoic acid (PubChem CID 24563287) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-[4-[(5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 24563287 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 3-[4-[(5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]phenyl]propanoic acid |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C17H18N2O6S2/c18-26(22,23)15-6-7-16-13(11-15)9-10-19(16)27(24,25)14-4-1-12(2-5-14)3-8-17(20)21/h1-2,4-7,11H,3,8-10H2,(H,20,21)(H2,18,22,23) |
| InChIKey | JQGMSJPMZZSEMN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |