C21H20N2O2S — CID 34913237
1-[(4-phenylphenyl)methyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 34913237) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-[(4-phenylphenyl)methyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[(4-phenylphenyl)methyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 34913237 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[(4-phenylphenyl)methyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c22-26(24,25)20-10-11-21-19(14-20)12-13-23(21)15-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-11,14H,12-13,15H2,(H2,22,24,25) |
| InChIKey | ARGBGLXPVHNRKT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |