C11H17N3O2S — CID 28917333
1-(3-aminopropyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 28917333) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-(3-aminopropyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(3-aminopropyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 28917333 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-(3-aminopropyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | NCCCN1CCc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C11H17N3O2S/c12-5-1-6-14-7-4-9-8-10(17(13,15)16)2-3-11(9)14/h2-3,8H,1,4-7,12H2,(H2,13,15,16) |
| InChIKey | FMXYAHDYNDSDEY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |