C16H15ClFN3O3S — CID 17407802
N-(5-chloro-2-fluorophenyl)-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide (PubChem CID 17407802) has the molecular formula C16H15ClFN3O3S and a molecular weight of 383.83 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 17407802 |
| Molecular Formula | C16H15ClFN3O3S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2CC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H15ClFN3O3S/c17-11-1-3-13(18)14(8-11)20-16(22)9-21-6-5-10-7-12(25(19,23)24)2-4-15(10)21/h1-4,7-8H,5-6,9H2,(H,20,22)(H2,19,23,24) |
| InChIKey | NKDDEORNZKXJPU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |