C20H23N3O3S — CID 60504798
N-(1-phenylcyclobutyl)-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide (PubChem CID 60504798) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(1-phenylcyclobutyl)-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide.
| Compound Name | N-(1-phenylcyclobutyl)-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 60504798 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(1-phenylcyclobutyl)-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2CC(=O)NC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C20H23N3O3S/c21-27(25,26)17-7-8-18-15(13-17)9-12-23(18)14-19(24)22-20(10-4-11-20)16-5-2-1-3-6-16/h1-3,5-8,13H,4,9-12,14H2,(H,22,24)(H2,21,25,26) |
| InChIKey | LLEQRVXFGVQSPX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |