C15H15BrN2O2S — CID 17398357
1-[(2-bromophenyl)methyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 17398357) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[(2-bromophenyl)methyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 17398357 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2Cc1ccccc1Br |
| InChI | InChI=1S/C15H15BrN2O2S/c16-14-4-2-1-3-12(14)10-18-8-7-11-9-13(21(17,19)20)5-6-15(11)18/h1-6,9H,7-8,10H2,(H2,17,19,20) |
| InChIKey | ULCAFLBMHRXCDY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |