C15H14Cl2N2O2S — CID 36943943
1-[(2,6-dichlorophenyl)methyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 36943943) has the molecular formula C15H14Cl2N2O2S and a molecular weight of 357.26 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 36943943 |
| Molecular Formula | C15H14Cl2N2O2S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O2S/c16-13-2-1-3-14(17)12(13)9-19-7-6-10-8-11(22(18,20)21)4-5-15(10)19/h1-5,8H,6-7,9H2,(H2,18,20,21) |
| InChIKey | NQLHNPHKCGIBIK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |