C16H16N2O4S — CID 75386054
1-(1,3-benzodioxol-4-ylmethyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 75386054) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-4-ylmethyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(1,3-benzodioxol-4-ylmethyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 75386054 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-(1,3-benzodioxol-4-ylmethyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2Cc1cccc2c1OCO2 |
| InChI | InChI=1S/C16H16N2O4S/c17-23(19,20)13-4-5-14-11(8-13)6-7-18(14)9-12-2-1-3-15-16(12)22-10-21-15/h1-5,8H,6-7,9-10H2,(H2,17,19,20) |
| InChIKey | CHSUMZJZQTYVGO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_mannich(1)', 'substructure': 'N/A'} |
|---|