C19H20N4O3S — CID 55470772
N-(2-cyanoethyl)-N-phenyl-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide (PubChem CID 55470772) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-phenyl-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide.
| Compound Name | N-(2-cyanoethyl)-N-phenyl-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 55470772 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-(2-cyanoethyl)-N-phenyl-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetamide |
| SMILES | N#CCCN(C(=O)CN1CCc2cc(S(N)(=O)=O)ccc21)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O3S/c20-10-4-11-23(16-5-2-1-3-6-16)19(24)14-22-12-9-15-13-17(27(21,25)26)7-8-18(15)22/h1-3,5-8,13H,4,9,11-12,14H2,(H2,21,25,26) |
| InChIKey | WIWYQZPMIAGYCF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |