C16H17BrN2O2S — CID 34918768
(2S)-1-[(2-bromophenyl)methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 34918768) has the molecular formula C16H17BrN2O2S and a molecular weight of 381.30 g/mol. Its IUPAC name is (2S)-1-[(2-bromophenyl)methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | (2S)-1-[(2-bromophenyl)methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 34918768 |
| Molecular Formula | C16H17BrN2O2S |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (2S)-1-[(2-bromophenyl)methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | C[C@H]1Cc2cc(S(N)(=O)=O)ccc2N1Cc1ccccc1Br |
| InChI | InChI=1S/C16H17BrN2O2S/c1-11-8-13-9-14(22(18,20)21)6-7-16(13)19(11)10-12-4-2-3-5-15(12)17/h2-7,9,11H,8,10H2,1H3,(H2,18,20,21)/t11-/m0/s1 |
| InChIKey | MPEUYMUKFQZZCM-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |