C17H17N3O2S — CID 25412404
(2R)-1-[(2-cyanophenyl)methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 25412404) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is (2R)-1-[(2-cyanophenyl)methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | (2R)-1-[(2-cyanophenyl)methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 25412404 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (2R)-1-[(2-cyanophenyl)methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | C[C@@H]1Cc2cc(S(N)(=O)=O)ccc2N1Cc1ccccc1C#N |
| InChI | InChI=1S/C17H17N3O2S/c1-12-8-15-9-16(23(19,21)22)6-7-17(15)20(12)11-14-5-3-2-4-13(14)10-18/h2-7,9,12H,8,11H2,1H3,(H2,19,21,22)/t12-/m1/s1 |
| InChIKey | VMFLUDSDKZBEAA-GFCCVEGCSA-N |
| XLogP | 2.16 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |