C17H20N2O2S — CID 40809955
(2S)-2-methyl-1-[(3-methylphenyl)methyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 40809955) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is (2S)-2-methyl-1-[(3-methylphenyl)methyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | (2S)-2-methyl-1-[(3-methylphenyl)methyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 40809955 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (2S)-2-methyl-1-[(3-methylphenyl)methyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1cccc(CN2c3ccc(S(N)(=O)=O)cc3C[C@@H]2C)c1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12-4-3-5-14(8-12)11-19-13(2)9-15-10-16(22(18,20)21)6-7-17(15)19/h3-8,10,13H,9,11H2,1-2H3,(H2,18,20,21)/t13-/m0/s1 |
| InChIKey | PJMUEADTRFTDCB-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |