C16H18N2O4S2 — CID 1253684
(2R)-2-methyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 1253684) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (2R)-2-methyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | (2R)-2-methyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 1253684 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (2R)-2-methyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(S(N)(=O)=O)cc3C[C@H]2C)cc1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-11-3-5-14(6-4-11)24(21,22)18-12(2)9-13-10-15(23(17,19)20)7-8-16(13)18/h3-8,10,12H,9H2,1-2H3,(H2,17,19,20)/t12-/m1/s1 |
| InChIKey | DGBOQWCTZYDKCE-GFCCVEGCSA-N |
| XLogP | 1.78 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |