C15H14F2N2O4S2 — CID 24556080
1-(2,4-difluorophenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 24556080) has the molecular formula C15H14F2N2O4S2 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 24556080 |
| Molecular Formula | C15H14F2N2O4S2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC1Cc2cc(S(N)(=O)=O)ccc2N1S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H14F2N2O4S2/c1-9-6-10-7-12(24(18,20)21)3-4-14(10)19(9)25(22,23)15-5-2-11(16)8-13(15)17/h2-5,7-9H,6H2,1H3,(H2,18,20,21) |
| InChIKey | LKZXDSGJVSPKBT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |