C18H20N2O6S2 — CID 24556093
ethyl 4-[(2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate (PubChem CID 24556093) has the molecular formula C18H20N2O6S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is ethyl 4-[(2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate.
| Compound Name | ethyl 4-[(2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
|---|---|
| PubChem CID | 24556093 |
| Molecular Formula | C18H20N2O6S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | ethyl 4-[(2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2c3ccc(S(N)(=O)=O)cc3CC2C)cc1 |
| InChI | InChI=1S/C18H20N2O6S2/c1-3-26-18(21)13-4-6-15(7-5-13)28(24,25)20-12(2)10-14-11-16(27(19,22)23)8-9-17(14)20/h4-9,11-12H,3,10H2,1-2H3,(H2,19,22,23) |
| InChIKey | XRFGQKMJLUZSBY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |