C17H20N2O4S2 — CID 24556091
1-(2,5-dimethylphenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 24556091) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 24556091 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2c3ccc(S(N)(=O)=O)cc3CC2C)c1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-11-4-5-12(2)17(8-11)25(22,23)19-13(3)9-14-10-15(24(18,20)21)6-7-16(14)19/h4-8,10,13H,9H2,1-3H3,(H2,18,20,21) |
| InChIKey | UADFOQJLXHATHC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |