C21H20N2O4S2 — CID 39977365
(2S)-2-methyl-1-(2-phenylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 39977365) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (2S)-2-methyl-1-(2-phenylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | (2S)-2-methyl-1-(2-phenylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 39977365 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (2S)-2-methyl-1-(2-phenylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | C[C@H]1Cc2cc(S(N)(=O)=O)ccc2N1S(=O)(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4S2/c1-15-13-17-14-18(28(22,24)25)11-12-20(17)23(15)29(26,27)21-10-6-5-9-19(21)16-7-3-2-4-8-16/h2-12,14-15H,13H2,1H3,(H2,22,24,25)/t15-/m0/s1 |
| InChIKey | PHWMOIHHIOXOFT-HNNXBMFYSA-N |
| XLogP | 3.14 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |