C16H16ClN3O6S2 — CID 24563316
1-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 24563316) has the molecular formula C16H16ClN3O6S2 and a molecular weight of 445.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 24563316 |
| Molecular Formula | C16H16ClN3O6S2 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 1-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N2c3ccc(S(N)(=O)=O)cc3CC2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16ClN3O6S2/c1-9-5-11-6-12(27(18,23)24)3-4-15(11)19(9)28(25,26)13-7-14(17)10(2)16(8-13)20(21)22/h3-4,6-9H,5H2,1-2H3,(H2,18,23,24) |
| InChIKey | NEEZJKFYZVFLFP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|