C15H13BrClNO2S — CID 133239520
5-bromo-1-(4-chlorophenyl)sulfonyl-2-methyl-2,3-dihydroindole (PubChem CID 133239520) has the molecular formula C15H13BrClNO2S and a molecular weight of 386.70 g/mol. Its IUPAC name is 5-bromo-1-(4-chlorophenyl)sulfonyl-2-methyl-2,3-dihydroindole.
| Compound Name | 5-bromo-1-(4-chlorophenyl)sulfonyl-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 133239520 |
| Molecular Formula | C15H13BrClNO2S |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | 5-bromo-1-(4-chlorophenyl)sulfonyl-2-methyl-2,3-dihydroindole |
| SMILES | CC1Cc2cc(Br)ccc2N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13BrClNO2S/c1-10-8-11-9-12(16)2-7-15(11)18(10)21(19,20)14-5-3-13(17)4-6-14/h2-7,9-10H,8H2,1H3 |
| InChIKey | AANFXENUBZRVHA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |